C14H16FN3O3 — CID 111110961
N-[3-(4-fluorophenoxy)-2-hydroxypropyl]-1-methylpyrazole-4-carboxamide (PubChem CID 111110961) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is N-[3-(4-fluorophenoxy)-2-hydroxypropyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[3-(4-fluorophenoxy)-2-hydroxypropyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 111110961 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[3-(4-fluorophenoxy)-2-hydroxypropyl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NCC(O)COc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C14H16FN3O3/c1-18-8-10(6-17-18)14(20)16-7-12(19)9-21-13-4-2-11(15)3-5-13/h2-6,8,12,19H,7,9H2,1H3,(H,16,20) |
| InChIKey | KHZNOEAJPIQMBK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |