C9H8F3NO2S — CID 10610739
(NE)-1,1,1-trifluoro-N-[(4-methylphenyl)methylidene]methanesulfonamide (PubChem CID 10610739) has the molecular formula C9H8F3NO2S and a molecular weight of 251.23 g/mol. Its IUPAC name is (NE)-1,1,1-trifluoro-N-[(4-methylphenyl)methylidene]methanesulfonamide.
| Compound Name | (NE)-1,1,1-trifluoro-N-[(4-methylphenyl)methylidene]methanesulfonamide |
|---|---|
| PubChem CID | 10610739 |
| Molecular Formula | C9H8F3NO2S |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | (NE)-1,1,1-trifluoro-N-[(4-methylphenyl)methylidene]methanesulfonamide |
| SMILES | Cc1ccc(/C=N/S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H8F3NO2S/c1-7-2-4-8(5-3-7)6-13-16(14,15)9(10,11)12/h2-6H,1H3/b13-6+ |
| InChIKey | AHCAYOQZHPAUPE-AWNIVKPZSA-N |
| XLogP | 2.26 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|