C11H20N2O6S — CID 106107966
2-methoxy-3-[(1-methylsulfonylpiperidine-4-carbonyl)amino]propanoic acid (PubChem CID 106107966) has the molecular formula C11H20N2O6S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-methoxy-3-[(1-methylsulfonylpiperidine-4-carbonyl)amino]propanoic acid.
| Compound Name | 2-methoxy-3-[(1-methylsulfonylpiperidine-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 106107966 |
| Molecular Formula | C11H20N2O6S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-methoxy-3-[(1-methylsulfonylpiperidine-4-carbonyl)amino]propanoic acid |
| SMILES | COC(CNC(=O)C1CCN(S(C)(=O)=O)CC1)C(=O)O |
| InChI | InChI=1S/C11H20N2O6S/c1-19-9(11(15)16)7-12-10(14)8-3-5-13(6-4-8)20(2,17)18/h8-9H,3-7H2,1-2H3,(H,12,14)(H,15,16) |
| InChIKey | JGGNHCVGPXJJEE-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |