C12H22N2O5 — CID 106108800
2-methoxy-3-(3-piperidin-4-yloxypropanoylamino)propanoic acid (PubChem CID 106108800) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-methoxy-3-(3-piperidin-4-yloxypropanoylamino)propanoic acid.
| Compound Name | 2-methoxy-3-(3-piperidin-4-yloxypropanoylamino)propanoic acid |
|---|---|
| PubChem CID | 106108800 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2-methoxy-3-(3-piperidin-4-yloxypropanoylamino)propanoic acid |
| SMILES | COC(CNC(=O)CCOC1CCNCC1)C(=O)O |
| InChI | InChI=1S/C12H22N2O5/c1-18-10(12(16)17)8-14-11(15)4-7-19-9-2-5-13-6-3-9/h9-10,13H,2-8H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | VSNZHJLAWUUWCT-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |