C12H19N3O4S — CID 106111402
3-amino-2-methoxy-N-[2-methyl-5-(methylsulfamoyl)phenyl]propanamide (PubChem CID 106111402) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is 3-amino-2-methoxy-N-[2-methyl-5-(methylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-amino-2-methoxy-N-[2-methyl-5-(methylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 106111402 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 3-amino-2-methoxy-N-[2-methyl-5-(methylsulfamoyl)phenyl]propanamide |
| SMILES | CNS(=O)(=O)c1ccc(C)c(NC(=O)C(CN)OC)c1 |
| InChI | InChI=1S/C12H19N3O4S/c1-8-4-5-9(20(17,18)14-2)6-10(8)15-12(16)11(7-13)19-3/h4-6,11,14H,7,13H2,1-3H3,(H,15,16) |
| InChIKey | SRPFFECBQKWDOK-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |