C15H26N4O4S — CID 120501906
3-amino-N-[2-(2-methoxyethylamino)-5-(methylsulfamoyl)phenyl]-2-methylbutanamide (PubChem CID 120501906) has the molecular formula C15H26N4O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is 3-amino-N-[2-(2-methoxyethylamino)-5-(methylsulfamoyl)phenyl]-2-methylbutanamide.
| Compound Name | 3-amino-N-[2-(2-methoxyethylamino)-5-(methylsulfamoyl)phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 120501906 |
| Molecular Formula | C15H26N4O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 3-amino-N-[2-(2-methoxyethylamino)-5-(methylsulfamoyl)phenyl]-2-methylbutanamide |
| SMILES | CNS(=O)(=O)c1ccc(NCCOC)c(NC(=O)C(C)C(C)N)c1 |
| InChI | InChI=1S/C15H26N4O4S/c1-10(11(2)16)15(20)19-14-9-12(24(21,22)17-3)5-6-13(14)18-7-8-23-4/h5-6,9-11,17-18H,7-8,16H2,1-4H3,(H,19,20) |
| InChIKey | TVELOHOSHXOTGX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|