C18H25ClN4O4S — CID 119339072
4-(aminomethyl)-N-[2-(2-methoxyethylamino)-5-(methylsulfamoyl)phenyl]benzamide;hydrochloride (PubChem CID 119339072) has the molecular formula C18H25ClN4O4S and a molecular weight of 428.94 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[2-(2-methoxyethylamino)-5-(methylsulfamoyl)phenyl]benzamide;hydrochloride.
| Compound Name | 4-(aminomethyl)-N-[2-(2-methoxyethylamino)-5-(methylsulfamoyl)phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119339072 |
| Molecular Formula | C18H25ClN4O4S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 4-(aminomethyl)-N-[2-(2-methoxyethylamino)-5-(methylsulfamoyl)phenyl]benzamide;hydrochloride |
| SMILES | CNS(=O)(=O)c1ccc(NCCOC)c(NC(=O)c2ccc(CN)cc2)c1.Cl |
| InChI | InChI=1S/C18H24N4O4S.ClH/c1-20-27(24,25)15-7-8-16(21-9-10-26-2)17(11-15)22-18(23)14-5-3-13(12-19)4-6-14;/h3-8,11,20-21H,9-10,12,19H2,1-2H3,(H,22,23);1H |
| InChIKey | IGBOSSRZZTYDRD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|