C19H25ClN4O4S — CID 71849298
N-(3-chloro-2-methylphenyl)-2-[2-(2-methoxyethylamino)-5-(methylsulfamoyl)anilino]acetamide (PubChem CID 71849298) has the molecular formula C19H25ClN4O4S and a molecular weight of 440.95 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[2-(2-methoxyethylamino)-5-(methylsulfamoyl)anilino]acetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[2-(2-methoxyethylamino)-5-(methylsulfamoyl)anilino]acetamide |
|---|---|
| PubChem CID | 71849298 |
| Molecular Formula | C19H25ClN4O4S |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[2-(2-methoxyethylamino)-5-(methylsulfamoyl)anilino]acetamide |
| SMILES | CNS(=O)(=O)c1ccc(NCCOC)c(NCC(=O)Nc2cccc(Cl)c2C)c1 |
| InChI | InChI=1S/C19H25ClN4O4S/c1-13-15(20)5-4-6-16(13)24-19(25)12-23-18-11-14(29(26,27)21-2)7-8-17(18)22-9-10-28-3/h4-8,11,21-23H,9-10,12H2,1-3H3,(H,24,25) |
| InChIKey | MXHACEVCMKRUKD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|