C18H23N3O4S — CID 119331638
4-(aminomethyl)-N-[5-(dimethylsulfamoyl)-2-ethoxyphenyl]benzamide (PubChem CID 119331638) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[5-(dimethylsulfamoyl)-2-ethoxyphenyl]benzamide.
| Compound Name | 4-(aminomethyl)-N-[5-(dimethylsulfamoyl)-2-ethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 119331638 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 4-(aminomethyl)-N-[5-(dimethylsulfamoyl)-2-ethoxyphenyl]benzamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)c1ccc(CN)cc1 |
| InChI | InChI=1S/C18H23N3O4S/c1-4-25-17-10-9-15(26(23,24)21(2)3)11-16(17)20-18(22)14-7-5-13(12-19)6-8-14/h5-11H,4,12,19H2,1-3H3,(H,20,22) |
| InChIKey | LMIXJMUATBQABD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |