C13H26O3Si — CID 10611259
tert-butyl-[(E,2S)-4-(1,3-dioxolan-2-yl)but-3-en-2-yl]oxy-dimethylsilane (PubChem CID 10611259) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is tert-butyl-[(E,2S)-4-(1,3-dioxolan-2-yl)but-3-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2S)-4-(1,3-dioxolan-2-yl)but-3-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10611259 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | tert-butyl-[(E,2S)-4-(1,3-dioxolan-2-yl)but-3-en-2-yl]oxy-dimethylsilane |
| SMILES | C[C@@H](/C=C/C1OCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O3Si/c1-11(7-8-12-14-9-10-15-12)16-17(5,6)13(2,3)4/h7-8,11-12H,9-10H2,1-6H3/b8-7+/t11-/m0/s1 |
| InChIKey | YYGQKDWYNVSGED-AEZGRPFRSA-N |
| XLogP | 3.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|