C8H13N3O4 — CID 106113080
4-(3-amino-2-methoxypropanoyl)piperazine-2,6-dione (PubChem CID 106113080) has the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. Its IUPAC name is 4-(3-amino-2-methoxypropanoyl)piperazine-2,6-dione.
| Compound Name | 4-(3-amino-2-methoxypropanoyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 106113080 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 4-(3-amino-2-methoxypropanoyl)piperazine-2,6-dione |
| SMILES | COC(CN)C(=O)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C8H13N3O4/c1-15-5(2-9)8(14)11-3-6(12)10-7(13)4-11/h5H,2-4,9H2,1H3,(H,10,12,13) |
| InChIKey | CWPLXORXNGFMKN-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|