C13H25NO3 — CID 106115815
(Z)-2-ethyl-4-[2-(2-hydroxyethyl)pentylamino]but-2-enoic acid (PubChem CID 106115815) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (Z)-2-ethyl-4-[2-(2-hydroxyethyl)pentylamino]but-2-enoic acid.
| Compound Name | (Z)-2-ethyl-4-[2-(2-hydroxyethyl)pentylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 106115815 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | (Z)-2-ethyl-4-[2-(2-hydroxyethyl)pentylamino]but-2-enoic acid |
| SMILES | CCCC(CCO)CNC/C=C(/CC)C(=O)O |
| InChI | InChI=1S/C13H25NO3/c1-3-5-11(7-9-15)10-14-8-6-12(4-2)13(16)17/h6,11,14-15H,3-5,7-10H2,1-2H3,(H,16,17)/b12-6- |
| InChIKey | PSXNRFHKDWLWTF-SDQBBNPISA-N |
| XLogP | 1.80 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|