C12H23NO2 — CID 103248445
(Z)-2-ethyl-4-(hexan-3-ylamino)but-2-enoic acid (PubChem CID 103248445) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is (Z)-2-ethyl-4-(hexan-3-ylamino)but-2-enoic acid.
| Compound Name | (Z)-2-ethyl-4-(hexan-3-ylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 103248445 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (Z)-2-ethyl-4-(hexan-3-ylamino)but-2-enoic acid |
| SMILES | CCCC(CC)NC/C=C(/CC)C(=O)O |
| InChI | InChI=1S/C12H23NO2/c1-4-7-11(6-3)13-9-8-10(5-2)12(14)15/h8,11,13H,4-7,9H2,1-3H3,(H,14,15)/b10-8- |
| InChIKey | CUSRMKUPYNPEJM-NTMALXAHSA-N |
| XLogP | 2.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|