C12H22FO3P — CID 10611631
1-diethoxyphosphoryl-1-fluoroocta-1,2-diene (PubChem CID 10611631) has the molecular formula C12H22FO3P and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1-fluoroocta-1,2-diene.
| Compound Name | 1-diethoxyphosphoryl-1-fluoroocta-1,2-diene |
|---|---|
| PubChem CID | 10611631 |
| Molecular Formula | C12H22FO3P |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-diethoxyphosphoryl-1-fluoroocta-1,2-diene |
| SMILES | CCCCCC=C=C(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C12H22FO3P/c1-4-7-8-9-10-11-12(13)17(14,15-5-2)16-6-3/h10H,4-9H2,1-3H3 |
| InChIKey | SVYZEDWKRGYAII-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|