C9H20BrNO4S2 — CID 106118413
N-[2-(2-bromoethyl)pentyl]-1-methylsulfonylmethanesulfonamide (PubChem CID 106118413) has the molecular formula C9H20BrNO4S2 and a molecular weight of 350.30 g/mol. Its IUPAC name is N-[2-(2-bromoethyl)pentyl]-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-[2-(2-bromoethyl)pentyl]-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 106118413 |
| Molecular Formula | C9H20BrNO4S2 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | N-[2-(2-bromoethyl)pentyl]-1-methylsulfonylmethanesulfonamide |
| SMILES | CCCC(CCBr)CNS(=O)(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C9H20BrNO4S2/c1-3-4-9(5-6-10)7-11-17(14,15)8-16(2,12)13/h9,11H,3-8H2,1-2H3 |
| InChIKey | XSMHNVQBZKRWBV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|