C8H18BrNO4S2 — CID 82843498
N-(4-bromo-2-ethylbutyl)-1-methylsulfonylmethanesulfonamide (PubChem CID 82843498) has the molecular formula C8H18BrNO4S2 and a molecular weight of 336.27 g/mol. Its IUPAC name is N-(4-bromo-2-ethylbutyl)-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-(4-bromo-2-ethylbutyl)-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 82843498 |
| Molecular Formula | C8H18BrNO4S2 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | N-(4-bromo-2-ethylbutyl)-1-methylsulfonylmethanesulfonamide |
| SMILES | CCC(CCBr)CNS(=O)(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C8H18BrNO4S2/c1-3-8(4-5-9)6-10-16(13,14)7-15(2,11)12/h8,10H,3-7H2,1-2H3 |
| InChIKey | IOJFDCQOQCZENL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|