C13H19N3O2 — CID 106118737
3,5-diamino-N-[(3-hydroxycyclopentyl)methyl]benzamide (PubChem CID 106118737) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 3,5-diamino-N-[(3-hydroxycyclopentyl)methyl]benzamide.
| Compound Name | 3,5-diamino-N-[(3-hydroxycyclopentyl)methyl]benzamide |
|---|---|
| PubChem CID | 106118737 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 3,5-diamino-N-[(3-hydroxycyclopentyl)methyl]benzamide |
| SMILES | Nc1cc(N)cc(C(=O)NCC2CCC(O)C2)c1 |
| InChI | InChI=1S/C13H19N3O2/c14-10-4-9(5-11(15)6-10)13(18)16-7-8-1-2-12(17)3-8/h4-6,8,12,17H,1-3,7,14-15H2,(H,16,18) |
| InChIKey | LIICZQRGFMOEQC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|