C15H22N2O2 — CID 106119007
2-(2-aminophenyl)-N-[(4-hydroxycyclohexyl)methyl]acetamide (PubChem CID 106119007) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N-[(4-hydroxycyclohexyl)methyl]acetamide.
| Compound Name | 2-(2-aminophenyl)-N-[(4-hydroxycyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 106119007 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-(2-aminophenyl)-N-[(4-hydroxycyclohexyl)methyl]acetamide |
| SMILES | Nc1ccccc1CC(=O)NCC1CCC(O)CC1 |
| InChI | InChI=1S/C15H22N2O2/c16-14-4-2-1-3-12(14)9-15(19)17-10-11-5-7-13(18)8-6-11/h1-4,11,13,18H,5-10,16H2,(H,17,19) |
| InChIKey | QNFPZWDIJOEKTK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|