C11H19ClF3NO — CID 106121284
N-[(3-chlorocyclopentyl)methyl]-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 106121284) has the molecular formula C11H19ClF3NO and a molecular weight of 273.73 g/mol. Its IUPAC name is N-[(3-chlorocyclopentyl)methyl]-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | N-[(3-chlorocyclopentyl)methyl]-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 106121284 |
| Molecular Formula | C11H19ClF3NO |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[(3-chlorocyclopentyl)methyl]-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | FC(F)(F)COCCCNCC1CCC(Cl)C1 |
| InChI | InChI=1S/C11H19ClF3NO/c12-10-3-2-9(6-10)7-16-4-1-5-17-8-11(13,14)15/h9-10,16H,1-8H2 |
| InChIKey | WKYQFSYDQBLAGP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|