C12H20ClF3O — CID 64507072
1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cycloheptane (PubChem CID 64507072) has the molecular formula C12H20ClF3O and a molecular weight of 272.74 g/mol. Its IUPAC name is 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cycloheptane.
| Compound Name | 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cycloheptane |
|---|---|
| PubChem CID | 64507072 |
| Molecular Formula | C12H20ClF3O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-chloro-3-[3-(2,2,2-trifluoroethoxy)propyl]cycloheptane |
| SMILES | FC(F)(F)COCCCC1CCCCC(Cl)C1 |
| InChI | InChI=1S/C12H20ClF3O/c13-11-6-2-1-4-10(8-11)5-3-7-17-9-12(14,15)16/h10-11H,1-9H2 |
| InChIKey | MIVLQDHSSNKGOU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|