C14H19BrClN — CID 106123141
N-[(4-bromophenyl)methyl]-1-(4-chlorocyclohexyl)methanamine (PubChem CID 106123141) has the molecular formula C14H19BrClN and a molecular weight of 316.67 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-1-(4-chlorocyclohexyl)methanamine.
| Compound Name | N-[(4-bromophenyl)methyl]-1-(4-chlorocyclohexyl)methanamine |
|---|---|
| PubChem CID | 106123141 |
| Molecular Formula | C14H19BrClN |
| Molecular Weight | 316.67 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-1-(4-chlorocyclohexyl)methanamine |
| SMILES | ClC1CCC(CNCc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C14H19BrClN/c15-13-5-1-11(2-6-13)9-17-10-12-3-7-14(16)8-4-12/h1-2,5-6,12,14,17H,3-4,7-10H2 |
| InChIKey | BDAQYQICZPBYRT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.67 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|