C9H7ClN2O2S2 — CID 10612415
2-benzylsulfonyl-5-chloro-1,3,4-thiadiazole (PubChem CID 10612415) has the molecular formula C9H7ClN2O2S2 and a molecular weight of 274.75 g/mol. Its IUPAC name is 2-benzylsulfonyl-5-chloro-1,3,4-thiadiazole.
| Compound Name | 2-benzylsulfonyl-5-chloro-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 10612415 |
| Molecular Formula | C9H7ClN2O2S2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 273.96 |
| IUPAC Name | 2-benzylsulfonyl-5-chloro-1,3,4-thiadiazole |
| SMILES | O=S(=O)(Cc1ccccc1)c1nnc(Cl)s1 |
| InChI | InChI=1S/C9H7ClN2O2S2/c10-8-11-12-9(15-8)16(13,14)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | UDMXIWUMZYFRNM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |