C15H12N2O2S3 — CID 10593873
2-(benzenesulfonyl)-5-benzylsulfanyl-1,3,4-thiadiazole (PubChem CID 10593873) has the molecular formula C15H12N2O2S3 and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-5-benzylsulfanyl-1,3,4-thiadiazole.
| Compound Name | 2-(benzenesulfonyl)-5-benzylsulfanyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 10593873 |
| Molecular Formula | C15H12N2O2S3 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 2-(benzenesulfonyl)-5-benzylsulfanyl-1,3,4-thiadiazole |
| SMILES | O=S(=O)(c1ccccc1)c1nnc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C15H12N2O2S3/c18-22(19,13-9-5-2-6-10-13)15-17-16-14(21-15)20-11-12-7-3-1-4-8-12/h1-10H,11H2 |
| InChIKey | UTYSEELDDGOMBX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |