C16H13ClN2O4S3 — CID 139221928
2-benzylsulfonyl-5-[4-(chloromethyl)phenyl]sulfonyl-1,3,4-thiadiazole (PubChem CID 139221928) has the molecular formula C16H13ClN2O4S3 and a molecular weight of 428.94 g/mol. Its IUPAC name is 2-benzylsulfonyl-5-[4-(chloromethyl)phenyl]sulfonyl-1,3,4-thiadiazole.
| Compound Name | 2-benzylsulfonyl-5-[4-(chloromethyl)phenyl]sulfonyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 139221928 |
| Molecular Formula | C16H13ClN2O4S3 |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | 2-benzylsulfonyl-5-[4-(chloromethyl)phenyl]sulfonyl-1,3,4-thiadiazole |
| SMILES | O=S(=O)(Cc1ccccc1)c1nnc(S(=O)(=O)c2ccc(CCl)cc2)s1 |
| InChI | InChI=1S/C16H13ClN2O4S3/c17-10-12-6-8-14(9-7-12)26(22,23)16-19-18-15(24-16)25(20,21)11-13-4-2-1-3-5-13/h1-9H,10-11H2 |
| InChIKey | RJPFUGQWZPTTFE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|