C16H14N2O2S3 — CID 10713696
2-benzylsulfanyl-5-(4-methylphenyl)sulfonyl-1,3,4-thiadiazole (PubChem CID 10713696) has the molecular formula C16H14N2O2S3 and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-(4-methylphenyl)sulfonyl-1,3,4-thiadiazole.
| Compound Name | 2-benzylsulfanyl-5-(4-methylphenyl)sulfonyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 10713696 |
| Molecular Formula | C16H14N2O2S3 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 2-benzylsulfanyl-5-(4-methylphenyl)sulfonyl-1,3,4-thiadiazole |
| SMILES | Cc1ccc(S(=O)(=O)c2nnc(SCc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C16H14N2O2S3/c1-12-7-9-14(10-8-12)23(19,20)16-18-17-15(22-16)21-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3 |
| InChIKey | FRRCPTKJMXLYQD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |