C16H13ClN2O2S3 — CID 139221927
2-benzylsulfanyl-5-[4-(chloromethyl)phenyl]sulfonyl-1,3,4-thiadiazole (PubChem CID 139221927) has the molecular formula C16H13ClN2O2S3 and a molecular weight of 396.95 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-[4-(chloromethyl)phenyl]sulfonyl-1,3,4-thiadiazole.
| Compound Name | 2-benzylsulfanyl-5-[4-(chloromethyl)phenyl]sulfonyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 139221927 |
| Molecular Formula | C16H13ClN2O2S3 |
| Molecular Weight | 396.95 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 2-benzylsulfanyl-5-[4-(chloromethyl)phenyl]sulfonyl-1,3,4-thiadiazole |
| SMILES | O=S(=O)(c1ccc(CCl)cc1)c1nnc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C16H13ClN2O2S3/c17-10-12-6-8-14(9-7-12)24(20,21)16-19-18-15(23-16)22-11-13-4-2-1-3-5-13/h1-9H,10-11H2 |
| InChIKey | DZVUZQDLEQTEFQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.95 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|