C16H14N2O2S3 — CID 135082600
4-methyl-N-[(Z)-(4-phenyl-1,3-dithiol-2-ylidene)amino]benzenesulfonamide (PubChem CID 135082600) has the molecular formula C16H14N2O2S3 and a molecular weight of 362.50 g/mol. Its IUPAC name is 4-methyl-N-[(Z)-(4-phenyl-1,3-dithiol-2-ylidene)amino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(Z)-(4-phenyl-1,3-dithiol-2-ylidene)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 135082600 |
| Molecular Formula | C16H14N2O2S3 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 4-methyl-N-[(Z)-(4-phenyl-1,3-dithiol-2-ylidene)amino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=c2/scc(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C16H14N2O2S3/c1-12-7-9-14(10-8-12)23(19,20)18-17-16-21-11-15(22-16)13-5-3-2-4-6-13/h2-11,18H,1H3/b17-16- |
| InChIKey | OWWQVTIPQTYXHV-MSUUIHNZSA-N |
| XLogP | 3.58 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|