C16H14N2O4S5 — CID 18731428
2,5-bis[(4-methylphenyl)sulfonylsulfanyl]-1,3,4-thiadiazole (PubChem CID 18731428) has the molecular formula C16H14N2O4S5 and a molecular weight of 458.63 g/mol. Its IUPAC name is 2,5-bis[(4-methylphenyl)sulfonylsulfanyl]-1,3,4-thiadiazole.
| Compound Name | 2,5-bis[(4-methylphenyl)sulfonylsulfanyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 18731428 |
| Molecular Formula | C16H14N2O4S5 |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 457.96 |
| IUPAC Name | 2,5-bis[(4-methylphenyl)sulfonylsulfanyl]-1,3,4-thiadiazole |
| SMILES | Cc1ccc(S(=O)(=O)Sc2nnc(SS(=O)(=O)c3ccc(C)cc3)s2)cc1 |
| InChI | InChI=1S/C16H14N2O4S5/c1-11-3-7-13(8-4-11)26(19,20)24-15-17-18-16(23-15)25-27(21,22)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | IRWWHGDMLLAFJL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 94.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|