C17H17NO3S2 — CID 177432416
N,N-dimethyl-3-(4-methylphenyl)sulfonylsulfanyl-1-benzofuran-2-amine (PubChem CID 177432416) has the molecular formula C17H17NO3S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is N,N-dimethyl-3-(4-methylphenyl)sulfonylsulfanyl-1-benzofuran-2-amine.
| Compound Name | N,N-dimethyl-3-(4-methylphenyl)sulfonylsulfanyl-1-benzofuran-2-amine |
|---|---|
| PubChem CID | 177432416 |
| Molecular Formula | C17H17NO3S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N,N-dimethyl-3-(4-methylphenyl)sulfonylsulfanyl-1-benzofuran-2-amine |
| SMILES | Cc1ccc(S(=O)(=O)Sc2c(N(C)C)oc3ccccc23)cc1 |
| InChI | InChI=1S/C17H17NO3S2/c1-12-8-10-13(11-9-12)23(19,20)22-16-14-6-4-5-7-15(14)21-17(16)18(2)3/h4-11H,1-3H3 |
| InChIKey | VEGZYWYTFICMRO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|