C7H16F3N3O2S — CID 106125687
1-N-(2,2,2-trifluoroethylsulfamoyl)pentane-1,4-diamine (PubChem CID 106125687) has the molecular formula C7H16F3N3O2S and a molecular weight of 263.28 g/mol. Its IUPAC name is 1-N-(2,2,2-trifluoroethylsulfamoyl)pentane-1,4-diamine.
| Compound Name | 1-N-(2,2,2-trifluoroethylsulfamoyl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 106125687 |
| Molecular Formula | C7H16F3N3O2S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-N-(2,2,2-trifluoroethylsulfamoyl)pentane-1,4-diamine |
| SMILES | CC(N)CCCNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H16F3N3O2S/c1-6(11)3-2-4-12-16(14,15)13-5-7(8,9)10/h6,12-13H,2-5,11H2,1H3 |
| InChIKey | SSTDXRCWNAZTPL-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|