C10H18BrNO2 — CID 106128023
2-bromo-N-[(3-hydroxycyclohexyl)methyl]propanamide (PubChem CID 106128023) has the molecular formula C10H18BrNO2 and a molecular weight of 264.16 g/mol. Its IUPAC name is 2-bromo-N-[(3-hydroxycyclohexyl)methyl]propanamide.
| Compound Name | 2-bromo-N-[(3-hydroxycyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 106128023 |
| Molecular Formula | C10H18BrNO2 |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-bromo-N-[(3-hydroxycyclohexyl)methyl]propanamide |
| SMILES | CC(Br)C(=O)NCC1CCCC(O)C1 |
| InChI | InChI=1S/C10H18BrNO2/c1-7(11)10(14)12-6-8-3-2-4-9(13)5-8/h7-9,13H,2-6H2,1H3,(H,12,14) |
| InChIKey | WLOMAOWBXVKSQJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|