C19H22O2 — CID 10612906
8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-3,4-diol (PubChem CID 10612906) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-3,4-diol.
| Compound Name | 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-3,4-diol |
|---|---|
| PubChem CID | 10612906 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 8,8-dimethyl-2-propan-2-yl-7H-phenanthrene-3,4-diol |
| SMILES | CC(C)c1cc2ccc3c(c2c(O)c1O)C=CCC3(C)C |
| InChI | InChI=1S/C19H22O2/c1-11(2)14-10-12-7-8-15-13(6-5-9-19(15,3)4)16(12)18(21)17(14)20/h5-8,10-11,20-21H,9H2,1-4H3 |
| InChIKey | JXNHHFHMEKYSCJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|