C14H22N4O — CID 106129174
4-[(4-aminocyclohexyl)methylamino]-N-methylpyridine-2-carboxamide (PubChem CID 106129174) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 4-[(4-aminocyclohexyl)methylamino]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[(4-aminocyclohexyl)methylamino]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 106129174 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 4-[(4-aminocyclohexyl)methylamino]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(NCC2CCC(N)CC2)ccn1 |
| InChI | InChI=1S/C14H22N4O/c1-16-14(19)13-8-12(6-7-17-13)18-9-10-2-4-11(15)5-3-10/h6-8,10-11H,2-5,9,15H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | OHDPBVVFPLGWSS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |