C12H18N2O — CID 106130739
4-[(pyridin-4-ylamino)methyl]cyclohexan-1-ol (PubChem CID 106130739) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-[(pyridin-4-ylamino)methyl]cyclohexan-1-ol.
| Compound Name | 4-[(pyridin-4-ylamino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106130739 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 4-[(pyridin-4-ylamino)methyl]cyclohexan-1-ol |
| SMILES | OC1CCC(CNc2ccncc2)CC1 |
| InChI | InChI=1S/C12H18N2O/c15-12-3-1-10(2-4-12)9-14-11-5-7-13-8-6-11/h5-8,10,12,15H,1-4,9H2,(H,13,14) |
| InChIKey | CZBYJRYEPMNLIW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |