C12H16N2 — CID 131084058
N-[(2-cyclopropylcyclopropyl)methyl]pyridin-4-amine (PubChem CID 131084058) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N-[(2-cyclopropylcyclopropyl)methyl]pyridin-4-amine.
| Compound Name | N-[(2-cyclopropylcyclopropyl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 131084058 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N-[(2-cyclopropylcyclopropyl)methyl]pyridin-4-amine |
| SMILES | c1cc(NCC2CC2C2CC2)ccn1 |
| InChI | InChI=1S/C12H16N2/c1-2-9(1)12-7-10(12)8-14-11-3-5-13-6-4-11/h3-6,9-10,12H,1-2,7-8H2,(H,13,14) |
| InChIKey | UVAMIYABVZOYLR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |