C13H17Cl2NOS — CID 106132295
3-chloro-N-[(3-chlorocyclohexyl)methyl]-4-methylthiophene-2-carboxamide (PubChem CID 106132295) has the molecular formula C13H17Cl2NOS and a molecular weight of 306.26 g/mol. Its IUPAC name is 3-chloro-N-[(3-chlorocyclohexyl)methyl]-4-methylthiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(3-chlorocyclohexyl)methyl]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 106132295 |
| Molecular Formula | C13H17Cl2NOS |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-chloro-N-[(3-chlorocyclohexyl)methyl]-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)NCC2CCCC(Cl)C2)c1Cl |
| InChI | InChI=1S/C13H17Cl2NOS/c1-8-7-18-12(11(8)15)13(17)16-6-9-3-2-4-10(14)5-9/h7,9-10H,2-6H2,1H3,(H,16,17) |
| InChIKey | GQJVGSYGDUINPO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|