C17H24N2O2 — CID 10613358
methyl 2,2-bis(3-ethyl-4-methyl-1H-pyrrol-2-yl)acetate (PubChem CID 10613358) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is methyl 2,2-bis(3-ethyl-4-methyl-1H-pyrrol-2-yl)acetate.
| Compound Name | methyl 2,2-bis(3-ethyl-4-methyl-1H-pyrrol-2-yl)acetate |
|---|---|
| PubChem CID | 10613358 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | methyl 2,2-bis(3-ethyl-4-methyl-1H-pyrrol-2-yl)acetate |
| SMILES | CCc1c(C)c[nH]c1C(C(=O)OC)c1[nH]cc(C)c1CC |
| InChI | InChI=1S/C17H24N2O2/c1-6-12-10(3)8-18-15(12)14(17(20)21-5)16-13(7-2)11(4)9-19-16/h8-9,14,18-19H,6-7H2,1-5H3 |
| InChIKey | IAURLADTGGIUFJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |