C11H17ClF3NO — CID 106134008
N-[(4-chlorocyclohexyl)methyl]-4,4,4-trifluorobutanamide (PubChem CID 106134008) has the molecular formula C11H17ClF3NO and a molecular weight of 271.71 g/mol. Its IUPAC name is N-[(4-chlorocyclohexyl)methyl]-4,4,4-trifluorobutanamide.
| Compound Name | N-[(4-chlorocyclohexyl)methyl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 106134008 |
| Molecular Formula | C11H17ClF3NO |
| Molecular Weight | 271.71 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-[(4-chlorocyclohexyl)methyl]-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)NCC1CCC(Cl)CC1 |
| InChI | InChI=1S/C11H17ClF3NO/c12-9-3-1-8(2-4-9)7-16-10(17)5-6-11(13,14)15/h8-9H,1-7H2,(H,16,17) |
| InChIKey | IRKUZTLKJLTHII-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.71 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|