C11H19N3O3 — CID 106134338
N-[(3-hydroxycyclopentyl)methyl]-5-oxopiperazine-2-carboxamide (PubChem CID 106134338) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is N-[(3-hydroxycyclopentyl)methyl]-5-oxopiperazine-2-carboxamide.
| Compound Name | N-[(3-hydroxycyclopentyl)methyl]-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 106134338 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | N-[(3-hydroxycyclopentyl)methyl]-5-oxopiperazine-2-carboxamide |
| SMILES | O=C1CNC(C(=O)NCC2CCC(O)C2)CN1 |
| InChI | InChI=1S/C11H19N3O3/c15-8-2-1-7(3-8)4-14-11(17)9-5-13-10(16)6-12-9/h7-9,12,15H,1-6H2,(H,13,16)(H,14,17) |
| InChIKey | WVTTUPOMBQGMHR-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |