C11H17N3O5 — CID 107437075
5-[[(5-oxopiperazine-2-carbonyl)amino]methyl]oxolane-2-carboxylic acid (PubChem CID 107437075) has the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. Its IUPAC name is 5-[[(5-oxopiperazine-2-carbonyl)amino]methyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[[(5-oxopiperazine-2-carbonyl)amino]methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 107437075 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 5-[[(5-oxopiperazine-2-carbonyl)amino]methyl]oxolane-2-carboxylic acid |
| SMILES | O=C1CNC(C(=O)NCC2CCC(C(=O)O)O2)CN1 |
| InChI | InChI=1S/C11H17N3O5/c15-9-5-12-7(4-13-9)10(16)14-3-6-1-2-8(19-6)11(17)18/h6-8,12H,1-5H2,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | XDTJQXHVEQUSCN-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |