C16H22ClNO2S — CID 106136241
N-[(4-chlorocyclohexyl)methyl]-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 106136241) has the molecular formula C16H22ClNO2S and a molecular weight of 327.88 g/mol. Its IUPAC name is N-[(4-chlorocyclohexyl)methyl]-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-[(4-chlorocyclohexyl)methyl]-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 106136241 |
| Molecular Formula | C16H22ClNO2S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-[(4-chlorocyclohexyl)methyl]-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | O=S(=O)(NCC1CCC(Cl)CC1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H22ClNO2S/c17-15-7-4-12(5-8-15)11-18-21(19,20)16-9-6-13-2-1-3-14(13)10-16/h6,9-10,12,15,18H,1-5,7-8,11H2 |
| InChIKey | GCAOEHYLXNYNGL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|