C10H16N4O — CID 106137884
3-[[(6-aminopyridazin-3-yl)amino]methyl]cyclopentan-1-ol (PubChem CID 106137884) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-[[(6-aminopyridazin-3-yl)amino]methyl]cyclopentan-1-ol.
| Compound Name | 3-[[(6-aminopyridazin-3-yl)amino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 106137884 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 3-[[(6-aminopyridazin-3-yl)amino]methyl]cyclopentan-1-ol |
| SMILES | Nc1ccc(NCC2CCC(O)C2)nn1 |
| InChI | InChI=1S/C10H16N4O/c11-9-3-4-10(14-13-9)12-6-7-1-2-8(15)5-7/h3-4,7-8,15H,1-2,5-6H2,(H2,11,13)(H,12,14) |
| InChIKey | IAADLOOLJXTYDK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |