C11H18N4 — CID 107415795
3-N-[(3-methylcyclopentyl)methyl]pyridazine-3,6-diamine (PubChem CID 107415795) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-N-[(3-methylcyclopentyl)methyl]pyridazine-3,6-diamine.
| Compound Name | 3-N-[(3-methylcyclopentyl)methyl]pyridazine-3,6-diamine |
|---|---|
| PubChem CID | 107415795 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 3-N-[(3-methylcyclopentyl)methyl]pyridazine-3,6-diamine |
| SMILES | CC1CCC(CNc2ccc(N)nn2)C1 |
| InChI | InChI=1S/C11H18N4/c1-8-2-3-9(6-8)7-13-11-5-4-10(12)14-15-11/h4-5,8-9H,2-3,6-7H2,1H3,(H2,12,14)(H,13,15) |
| InChIKey | NIFVZGCFIZUOTF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |