C8H12ClN3O5S — CID 106139008
2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-3-hydroxybutanoic acid (PubChem CID 106139008) has the molecular formula C8H12ClN3O5S and a molecular weight of 297.72 g/mol. Its IUPAC name is 2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-3-hydroxybutanoic acid.
| Compound Name | 2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 106139008 |
| Molecular Formula | C8H12ClN3O5S |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NS(=O)(=O)c1c(Cl)cnn1C)C(=O)O |
| InChI | InChI=1S/C8H12ClN3O5S/c1-4(13)6(8(14)15)11-18(16,17)7-5(9)3-10-12(7)2/h3-4,6,11,13H,1-2H3,(H,14,15) |
| InChIKey | CSGMPSHBPLSGEF-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |