C14H18O7 — CID 10613997
[(1R,2R,6S)-2-acetyloxy-5-oxo-6-propanoyloxycyclohex-3-en-1-yl] propanoate (PubChem CID 10613997) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is [(1R,2R,6S)-2-acetyloxy-5-oxo-6-propanoyloxycyclohex-3-en-1-yl] propanoate.
| Compound Name | [(1R,2R,6S)-2-acetyloxy-5-oxo-6-propanoyloxycyclohex-3-en-1-yl] propanoate |
|---|---|
| PubChem CID | 10613997 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [(1R,2R,6S)-2-acetyloxy-5-oxo-6-propanoyloxycyclohex-3-en-1-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H](OC(=O)CC)C(=O)C=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H18O7/c1-4-11(17)20-13-9(16)6-7-10(19-8(3)15)14(13)21-12(18)5-2/h6-7,10,13-14H,4-5H2,1-3H3/t10-,13-,14-/m1/s1 |
| InChIKey | ZSWLVYKVIIOFBO-LERXQTSPSA-N |
| XLogP | 0.70 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|