C15H26N2O3S — CID 106140110
5-amino-2-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)benzenesulfonamide (PubChem CID 106140110) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is 5-amino-2-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)benzenesulfonamide.
| Compound Name | 5-amino-2-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106140110 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 5-amino-2-ethyl-N-(5-hydroxy-2,2-dimethylpentyl)benzenesulfonamide |
| SMILES | CCc1ccc(N)cc1S(=O)(=O)NCC(C)(C)CCCO |
| InChI | InChI=1S/C15H26N2O3S/c1-4-12-6-7-13(16)10-14(12)21(19,20)17-11-15(2,3)8-5-9-18/h6-7,10,17-18H,4-5,8-9,11,16H2,1-3H3 |
| InChIKey | DZQNGZOOPUAMTN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|