C14H23N3O2 — CID 106140800
4-amino-2-[(4-hydroxy-2,2-dimethylbutyl)amino]-N-methylbenzamide (PubChem CID 106140800) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-amino-2-[(4-hydroxy-2,2-dimethylbutyl)amino]-N-methylbenzamide.
| Compound Name | 4-amino-2-[(4-hydroxy-2,2-dimethylbutyl)amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 106140800 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 4-amino-2-[(4-hydroxy-2,2-dimethylbutyl)amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(N)cc1NCC(C)(C)CCO |
| InChI | InChI=1S/C14H23N3O2/c1-14(2,6-7-18)9-17-12-8-10(15)4-5-11(12)13(19)16-3/h4-5,8,17-18H,6-7,9,15H2,1-3H3,(H,16,19) |
| InChIKey | QGFINZNIRDMYQO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|