C13H27N3O — CID 106141204
1-(4-amino-2,2-dimethylbutyl)-3-cyclohexylurea (PubChem CID 106141204) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-(4-amino-2,2-dimethylbutyl)-3-cyclohexylurea.
| Compound Name | 1-(4-amino-2,2-dimethylbutyl)-3-cyclohexylurea |
|---|---|
| PubChem CID | 106141204 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 1-(4-amino-2,2-dimethylbutyl)-3-cyclohexylurea |
| SMILES | CC(C)(CCN)CNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C13H27N3O/c1-13(2,8-9-14)10-15-12(17)16-11-6-4-3-5-7-11/h11H,3-10,14H2,1-2H3,(H2,15,16,17) |
| InChIKey | AHBHJKUWBYHQNA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |