C13H24N2O2 — CID 60970162
1-cyclohexyl-3-(3,3-dimethyl-2-oxobutyl)urea (PubChem CID 60970162) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3,3-dimethyl-2-oxobutyl)urea.
| Compound Name | 1-cyclohexyl-3-(3,3-dimethyl-2-oxobutyl)urea |
|---|---|
| PubChem CID | 60970162 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 1-cyclohexyl-3-(3,3-dimethyl-2-oxobutyl)urea |
| SMILES | CC(C)(C)C(=O)CNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C13H24N2O2/c1-13(2,3)11(16)9-14-12(17)15-10-7-5-4-6-8-10/h10H,4-9H2,1-3H3,(H2,14,15,17) |
| InChIKey | ZGJXBVDPWZAJRR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |