C10H19N3O2 — CID 38168189
2-(cyclopentylcarbamoylamino)-N,N-dimethylacetamide (PubChem CID 38168189) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-(cyclopentylcarbamoylamino)-N,N-dimethylacetamide.
| Compound Name | 2-(cyclopentylcarbamoylamino)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 38168189 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-(cyclopentylcarbamoylamino)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNC(=O)NC1CCCC1 |
| InChI | InChI=1S/C10H19N3O2/c1-13(2)9(14)7-11-10(15)12-8-5-3-4-6-8/h8H,3-7H2,1-2H3,(H2,11,12,15) |
| InChIKey | NBEWRVYQWKDWBL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |